C19H30N4O3 — CID 55746318
1-[1-(2-methylpropanoyl)piperidin-4-yl]-3-[(2-propan-2-yloxy-3-pyridinyl)methyl]urea (PubChem CID 55746318) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[1-(2-methylpropanoyl)piperidin-4-yl]-3-[(2-propan-2-yloxy-3-pyridinyl)methyl]urea.
| Compound Name | 1-[1-(2-methylpropanoyl)piperidin-4-yl]-3-[(2-propan-2-yloxy-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55746318 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 1-[1-(2-methylpropanoyl)piperidin-4-yl]-3-[(2-propan-2-yloxy-3-pyridinyl)methyl]urea |
| SMILES | CC(C)Oc1ncccc1CNC(=O)NC1CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C19H30N4O3/c1-13(2)18(24)23-10-7-16(8-11-23)22-19(25)21-12-15-6-5-9-20-17(15)26-14(3)4/h5-6,9,13-14,16H,7-8,10-12H2,1-4H3,(H2,21,22,25) |
| InChIKey | BXWIRVDEZSDDBR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |