C16H22N2O2 — CID 94179025
2-[(1S)-cyclopent-2-en-1-yl]-N-[(2-propan-2-yloxy-3-pyridinyl)methyl]acetamide (PubChem CID 94179025) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[(2-propan-2-yloxy-3-pyridinyl)methyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(2-propan-2-yloxy-3-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 94179025 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(2-propan-2-yloxy-3-pyridinyl)methyl]acetamide |
| SMILES | CC(C)Oc1ncccc1CNC(=O)C[C@H]1C=CCC1 |
| InChI | InChI=1S/C16H22N2O2/c1-12(2)20-16-14(8-5-9-17-16)11-18-15(19)10-13-6-3-4-7-13/h3,5-6,8-9,12-13H,4,7,10-11H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | LBOINVSJLVYBJM-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|