C20H24F4IN5O — CID 111915306
1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111915306) has the molecular formula C20H24F4IN5O and a molecular weight of 553.34 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111915306 |
| Molecular Formula | C20H24F4IN5O |
| Molecular Weight | 553.34 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccnc1Oc1cccc(F)c1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C20H23F4N5O.HI/c1-25-19(28-16-7-9-29(12-16)13-20(22,23)24)27-11-14-4-3-8-26-18(14)30-17-6-2-5-15(21)10-17;/h2-6,8,10,16H,7,9,11-13H2,1H3,(H2,25,27,28);1H |
| InChIKey | JCLYFLSNZPUQGZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|