C19H30F3N7 — CID 111913916
2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111913916) has the molecular formula C19H30F3N7 and a molecular weight of 413.49 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111913916 |
| Molecular Formula | C19H30F3N7 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(/NCc1cccnc1N1CCN(C)CC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C19H30F3N7/c1-23-18(26-16-5-7-28(13-16)14-19(20,21)22)25-12-15-4-3-6-24-17(15)29-10-8-27(2)9-11-29/h3-4,6,16H,5,7-14H2,1-2H3,(H2,23,25,26) |
| InChIKey | HJEYGXKVWZZMRP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|