C16H33Cl2N3O2 — CID 119849807
N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]morpholine-3-carboxamide;dihydrochloride (PubChem CID 119849807) has the molecular formula C16H33Cl2N3O2 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]morpholine-3-carboxamide;dihydrochloride.
| Compound Name | N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]morpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119849807 |
| Molecular Formula | C16H33Cl2N3O2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]morpholine-3-carboxamide;dihydrochloride |
| SMILES | CC1CCN(C(CNC(=O)C2COCCN2)C(C)C)CC1.Cl.Cl |
| InChI | InChI=1S/C16H31N3O2.2ClH/c1-12(2)15(19-7-4-13(3)5-8-19)10-18-16(20)14-11-21-9-6-17-14;;/h12-15,17H,4-11H2,1-3H3,(H,18,20);2*1H |
| InChIKey | GMVXEDXEFOTHCX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |