C11H23ClN2O3 — CID 119784019
N-(2-hydroxy-3-methylpentyl)morpholine-3-carboxamide;hydrochloride (PubChem CID 119784019) has the molecular formula C11H23ClN2O3 and a molecular weight of 266.77 g/mol. Its IUPAC name is N-(2-hydroxy-3-methylpentyl)morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-hydroxy-3-methylpentyl)morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119784019 |
| Molecular Formula | C11H23ClN2O3 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(2-hydroxy-3-methylpentyl)morpholine-3-carboxamide;hydrochloride |
| SMILES | CCC(C)C(O)CNC(=O)C1COCCN1.Cl |
| InChI | InChI=1S/C11H22N2O3.ClH/c1-3-8(2)10(14)6-13-11(15)9-7-16-5-4-12-9;/h8-10,12,14H,3-7H2,1-2H3,(H,13,15);1H |
| InChIKey | WTCAGSLXWWALBM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |