C15H26N4OS — CID 119851657
7-amino-1-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]heptan-1-one (PubChem CID 119851657) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 7-amino-1-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]heptan-1-one.
| Compound Name | 7-amino-1-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 119851657 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 7-amino-1-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]heptan-1-one |
| SMILES | Cc1csc(N2CCN(C(=O)CCCCCCN)CC2)n1 |
| InChI | InChI=1S/C15H26N4OS/c1-13-12-21-15(17-13)19-10-8-18(9-11-19)14(20)6-4-2-3-5-7-16/h12H,2-11,16H2,1H3 |
| InChIKey | VUQYIKDTVFJLMX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|