C16H29N5OS — CID 119899749
7-amino-1-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]heptan-1-one (PubChem CID 119899749) has the molecular formula C16H29N5OS and a molecular weight of 339.51 g/mol. Its IUPAC name is 7-amino-1-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]heptan-1-one.
| Compound Name | 7-amino-1-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 119899749 |
| Molecular Formula | C16H29N5OS |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 7-amino-1-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]heptan-1-one |
| SMILES | CCc1nsc(N2CCCN(C(=O)CCCCCCN)CC2)n1 |
| InChI | InChI=1S/C16H29N5OS/c1-2-14-18-16(23-19-14)21-11-7-10-20(12-13-21)15(22)8-5-3-4-6-9-17/h2-13,17H2,1H3 |
| InChIKey | QLEGKBKXFBMJPU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|