C15H28Cl2N4OS — CID 119852710
2-(aminomethyl)-N-[4-(3-methylpiperidin-1-yl)butyl]-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119852710) has the molecular formula C15H28Cl2N4OS and a molecular weight of 383.39 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[4-(3-methylpiperidin-1-yl)butyl]-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-(aminomethyl)-N-[4-(3-methylpiperidin-1-yl)butyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119852710 |
| Molecular Formula | C15H28Cl2N4OS |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-(aminomethyl)-N-[4-(3-methylpiperidin-1-yl)butyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CC1CCCN(CCCCNC(=O)c2csc(CN)n2)C1.Cl.Cl |
| InChI | InChI=1S/C15H26N4OS.2ClH/c1-12-5-4-8-19(10-12)7-3-2-6-17-15(20)13-11-21-14(9-16)18-13;;/h11-12H,2-10,16H2,1H3,(H,17,20);2*1H |
| InChIKey | UBQWMRYAWTZVNA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|