C14H26Cl2N4O2S — CID 119841026
2-(aminomethyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119841026) has the molecular formula C14H26Cl2N4O2S and a molecular weight of 385.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-(aminomethyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119841026 |
| Molecular Formula | C14H26Cl2N4O2S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CC1CN(CCCNC(=O)c2csc(CN)n2)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C14H24N4O2S.2ClH/c1-10-7-18(8-11(2)20-10)5-3-4-16-14(19)12-9-21-13(6-15)17-12;;/h9-11H,3-8,15H2,1-2H3,(H,16,19);2*1H |
| InChIKey | MDZNRWJSLLQCEC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|