C20H39N3O — CID 119852765
N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-piperidin-3-ylbutanamide (PubChem CID 119852765) has the molecular formula C20H39N3O and a molecular weight of 337.55 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119852765 |
| Molecular Formula | C20H39N3O |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.31 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC1CC(C)CN(CCCCNC(=O)CC(C)C2CCCNC2)C1 |
| InChI | InChI=1S/C20H39N3O/c1-16-11-17(2)15-23(14-16)10-5-4-9-22-20(24)12-18(3)19-7-6-8-21-13-19/h16-19,21H,4-15H2,1-3H3,(H,22,24) |
| InChIKey | PPHUVAISNFIQKA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|