C16H27Cl2N3O2 — CID 119853416
N-[2-(N-ethyl-2-methylanilino)ethyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119853416) has the molecular formula C16H27Cl2N3O2 and a molecular weight of 364.32 g/mol. Its IUPAC name is N-[2-(N-ethyl-2-methylanilino)ethyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119853416 |
| Molecular Formula | C16H27Cl2N3O2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CCN(CCNC(=O)C1CC(O)CN1)c1ccccc1C.Cl.Cl |
| InChI | InChI=1S/C16H25N3O2.2ClH/c1-3-19(15-7-5-4-6-12(15)2)9-8-17-16(21)14-10-13(20)11-18-14;;/h4-7,13-14,18,20H,3,8-11H2,1-2H3,(H,17,21);2*1H |
| InChIKey | MUTOLLAFJLXIIY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |