C14H24ClN3O — CID 120703807
N-[2-(N-ethyl-2-methylanilino)ethyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 120703807) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is N-[2-(N-ethyl-2-methylanilino)ethyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120703807 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCN(CCNC(=O)CNC)c1ccccc1C.Cl |
| InChI | InChI=1S/C14H23N3O.ClH/c1-4-17(10-9-16-14(18)11-15-3)13-8-6-5-7-12(13)2;/h5-8,15H,4,9-11H2,1-3H3,(H,16,18);1H |
| InChIKey | FAPWBXGRLUTZCH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |