C18H28N2O — CID 72689859
N-[2-(N-ethyl-2-methylanilino)ethyl]-4,4-dimethylpent-2-enamide (PubChem CID 72689859) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[2-(N-ethyl-2-methylanilino)ethyl]-4,4-dimethylpent-2-enamide.
| Compound Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 72689859 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[2-(N-ethyl-2-methylanilino)ethyl]-4,4-dimethylpent-2-enamide |
| SMILES | CCN(CCNC(=O)C=CC(C)(C)C)c1ccccc1C |
| InChI | InChI=1S/C18H28N2O/c1-6-20(16-10-8-7-9-15(16)2)14-13-19-17(21)11-12-18(3,4)5/h7-12H,6,13-14H2,1-5H3,(H,19,21) |
| InChIKey | FRSPJJRVZLMPCS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|