C19H22F2N2O2 — CID 46478861
2-(2,4-difluorophenoxy)-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide (PubChem CID 46478861) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 46478861 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-[2-(N-ethyl-2-methylanilino)ethyl]acetamide |
| SMILES | CCN(CCNC(=O)COc1ccc(F)cc1F)c1ccccc1C |
| InChI | InChI=1S/C19H22F2N2O2/c1-3-23(17-7-5-4-6-14(17)2)11-10-22-19(24)13-25-18-9-8-15(20)12-16(18)21/h4-9,12H,3,10-11,13H2,1-2H3,(H,22,24) |
| InChIKey | FYXRPQNYTCTRCV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |