C15H22N4O2 — CID 119855637
N-(5-piperidin-1-yl-2-pyridinyl)morpholine-3-carboxamide (PubChem CID 119855637) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-(5-piperidin-1-yl-2-pyridinyl)morpholine-3-carboxamide.
| Compound Name | N-(5-piperidin-1-yl-2-pyridinyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119855637 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-(5-piperidin-1-yl-2-pyridinyl)morpholine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cn1)C1COCCN1 |
| InChI | InChI=1S/C15H22N4O2/c20-15(13-11-21-9-6-16-13)18-14-5-4-12(10-17-14)19-7-2-1-3-8-19/h4-5,10,13,16H,1-3,6-9,11H2,(H,17,18,20) |
| InChIKey | HHQJYFTXGIMWQW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |