C12H20Cl2N4O2 — CID 119863150
N-[5-(dimethylamino)-2-pyridinyl]morpholine-3-carboxamide;dihydrochloride (PubChem CID 119863150) has the molecular formula C12H20Cl2N4O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is N-[5-(dimethylamino)-2-pyridinyl]morpholine-3-carboxamide;dihydrochloride.
| Compound Name | N-[5-(dimethylamino)-2-pyridinyl]morpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119863150 |
| Molecular Formula | C12H20Cl2N4O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[5-(dimethylamino)-2-pyridinyl]morpholine-3-carboxamide;dihydrochloride |
| SMILES | CN(C)c1ccc(NC(=O)C2COCCN2)nc1.Cl.Cl |
| InChI | InChI=1S/C12H18N4O2.2ClH/c1-16(2)9-3-4-11(14-7-9)15-12(17)10-8-18-6-5-13-10;;/h3-4,7,10,13H,5-6,8H2,1-2H3,(H,14,15,17);2*1H |
| InChIKey | BCMOSERPMFEGHS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |