C14H21N3O2 — CID 129400783
(2S,3S)-N-[5-(dimethylamino)-2-pyridinyl]-2-methyloxane-3-carboxamide (PubChem CID 129400783) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is (2S,3S)-N-[5-(dimethylamino)-2-pyridinyl]-2-methyloxane-3-carboxamide.
| Compound Name | (2S,3S)-N-[5-(dimethylamino)-2-pyridinyl]-2-methyloxane-3-carboxamide |
|---|---|
| PubChem CID | 129400783 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2S,3S)-N-[5-(dimethylamino)-2-pyridinyl]-2-methyloxane-3-carboxamide |
| SMILES | C[C@@H]1OCCC[C@@H]1C(=O)Nc1ccc(N(C)C)cn1 |
| InChI | InChI=1S/C14H21N3O2/c1-10-12(5-4-8-19-10)14(18)16-13-7-6-11(9-15-13)17(2)3/h6-7,9-10,12H,4-5,8H2,1-3H3,(H,15,16,18)/t10-,12-/m0/s1 |
| InChIKey | KZHCACJUWOUWBE-JQWIXIFHSA-N |
| XLogP | 1.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |