C15H26Cl2N4O2 — CID 119855694
2-(2-methoxyethylamino)-N-(5-piperidin-1-yl-2-pyridinyl)acetamide;dihydrochloride (PubChem CID 119855694) has the molecular formula C15H26Cl2N4O2 and a molecular weight of 365.31 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(5-piperidin-1-yl-2-pyridinyl)acetamide;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(5-piperidin-1-yl-2-pyridinyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119855694 |
| Molecular Formula | C15H26Cl2N4O2 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(5-piperidin-1-yl-2-pyridinyl)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(N2CCCCC2)cn1.Cl.Cl |
| InChI | InChI=1S/C15H24N4O2.2ClH/c1-21-10-7-16-12-15(20)18-14-6-5-13(11-17-14)19-8-3-2-4-9-19;;/h5-6,11,16H,2-4,7-10,12H2,1H3,(H,17,18,20);2*1H |
| InChIKey | CKFNDJAZJCSZFU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|