C13H26Cl2N4O — CID 119857824
2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]pentanamide;dihydrochloride (PubChem CID 119857824) has the molecular formula C13H26Cl2N4O and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]pentanamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119857824 |
| Molecular Formula | C13H26Cl2N4O |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]pentanamide;dihydrochloride |
| SMILES | CCCC(N)C(=O)NCC(C)Cn1ccnc1C.Cl.Cl |
| InChI | InChI=1S/C13H24N4O.2ClH/c1-4-5-12(14)13(18)16-8-10(2)9-17-7-6-15-11(17)3;;/h6-7,10,12H,4-5,8-9,14H2,1-3H3,(H,16,18);2*1H |
| InChIKey | GQHRZLGSVQZGRM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |