C17H26Cl2N4O — CID 120595719
2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-2-phenylpropanamide;dihydrochloride (PubChem CID 120595719) has the molecular formula C17H26Cl2N4O and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-2-phenylpropanamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-2-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595719 |
| Molecular Formula | C17H26Cl2N4O |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-amino-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-2-phenylpropanamide;dihydrochloride |
| SMILES | Cc1nccn1CC(C)CNC(=O)C(C)(N)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H24N4O.2ClH/c1-13(12-21-10-9-19-14(21)2)11-20-16(22)17(3,18)15-7-5-4-6-8-15;;/h4-10,13H,11-12,18H2,1-3H3,(H,20,22);2*1H |
| InChIKey | RLTAMOQLPKJWIR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |