C16H25Cl2N3O2 — CID 119858151
[4-(aminomethyl)phenyl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone;dihydrochloride (PubChem CID 119858151) has the molecular formula C16H25Cl2N3O2 and a molecular weight of 362.30 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone;dihydrochloride.
| Compound Name | [4-(aminomethyl)phenyl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119858151 |
| Molecular Formula | C16H25Cl2N3O2 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [4-(aminomethyl)phenyl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccc(C(=O)N2CCC(N3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C16H23N3O2.2ClH/c17-11-13-1-3-14(4-2-13)16(20)19-6-5-15(12-19)18-7-9-21-10-8-18;;/h1-4,15H,5-12,17H2;2*1H |
| InChIKey | DWZBNIJVWQAKET-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |