C15H19BrN2O3 — CID 103873505
(4-bromo-3-hydroxyphenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 103873505) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is (4-bromo-3-hydroxyphenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | (4-bromo-3-hydroxyphenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103873505 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (4-bromo-3-hydroxyphenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Br)c(O)c1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C15H19BrN2O3/c16-13-2-1-11(9-14(13)19)15(20)18-4-3-12(10-18)17-5-7-21-8-6-17/h1-2,9,12,19H,3-8,10H2 |
| InChIKey | MCTNZJZJBMMPOA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |