C16H26Cl2N4O3 — CID 119858407
(2S)-2-amino-4-methyl-1-[4-(3-nitrophenyl)piperazin-1-yl]pentan-1-one;dihydrochloride (PubChem CID 119858407) has the molecular formula C16H26Cl2N4O3 and a molecular weight of 393.32 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-1-[4-(3-nitrophenyl)piperazin-1-yl]pentan-1-one;dihydrochloride.
| Compound Name | (2S)-2-amino-4-methyl-1-[4-(3-nitrophenyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119858407 |
| Molecular Formula | C16H26Cl2N4O3 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S)-2-amino-4-methyl-1-[4-(3-nitrophenyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N1CCN(c2cccc([N+](=O)[O-])c2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H24N4O3.2ClH/c1-12(2)10-15(17)16(21)19-8-6-18(7-9-19)13-4-3-5-14(11-13)20(22)23;;/h3-5,11-12,15H,6-10,17H2,1-2H3;2*1H/t15-;;/m0../s1 |
| InChIKey | IQCIOPOESMFLLW-CKUXDGONSA-N |
| XLogP | 2.46 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|