C11H21Cl2N3O2S — CID 119858712
2-(2-methoxyethylamino)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]acetamide;dihydrochloride (PubChem CID 119858712) has the molecular formula C11H21Cl2N3O2S and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]acetamide;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119858712 |
| Molecular Formula | C11H21Cl2N3O2S |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NC(C)(C)c1nccs1.Cl.Cl |
| InChI | InChI=1S/C11H19N3O2S.2ClH/c1-11(2,10-13-5-7-17-10)14-9(15)8-12-4-6-16-3;;/h5,7,12H,4,6,8H2,1-3H3,(H,14,15);2*1H |
| InChIKey | OMQXIDHZOXBFNK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|