C17H26Cl2N4O2 — CID 119860409
2-amino-3-methyl-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]pentanamide;dihydrochloride (PubChem CID 119860409) has the molecular formula C17H26Cl2N4O2 and a molecular weight of 389.33 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]pentanamide;dihydrochloride.
| Compound Name | 2-amino-3-methyl-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119860409 |
| Molecular Formula | C17H26Cl2N4O2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-amino-3-methyl-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]pentanamide;dihydrochloride |
| SMILES | CCC(C)C(N)C(=O)Nc1ccc2nc(C3CCCO3)[nH]c2c1.Cl.Cl |
| InChI | InChI=1S/C17H24N4O2.2ClH/c1-3-10(2)15(18)17(22)19-11-6-7-12-13(9-11)21-16(20-12)14-5-4-8-23-14;;/h6-7,9-10,14-15H,3-5,8,18H2,1-2H3,(H,19,22)(H,20,21);2*1H |
| InChIKey | DOGKFKUFWYXQGT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |