C16H24Cl2N4O3 — CID 120595805
4-amino-3-methoxy-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]butanamide;dihydrochloride (PubChem CID 120595805) has the molecular formula C16H24Cl2N4O3 and a molecular weight of 391.30 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]butanamide;dihydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595805 |
| Molecular Formula | C16H24Cl2N4O3 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-amino-3-methoxy-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]butanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)Nc1ccc2nc(C3CCCO3)[nH]c2c1.Cl.Cl |
| InChI | InChI=1S/C16H22N4O3.2ClH/c1-22-11(9-17)8-15(21)18-10-4-5-12-13(7-10)20-16(19-12)14-3-2-6-23-14;;/h4-5,7,11,14H,2-3,6,8-9,17H2,1H3,(H,18,21)(H,19,20);2*1H |
| InChIKey | MGHQJGIWQQIBLC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |