C13H29Cl2N3O — CID 119860550
N-[1-(diethylamino)propan-2-yl]-3-methylpyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119860550) has the molecular formula C13H29Cl2N3O and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[1-(diethylamino)propan-2-yl]-3-methylpyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[1-(diethylamino)propan-2-yl]-3-methylpyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119860550 |
| Molecular Formula | C13H29Cl2N3O |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[1-(diethylamino)propan-2-yl]-3-methylpyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | CCN(CC)CC(C)NC(=O)C1(C)CCNC1.Cl.Cl |
| InChI | InChI=1S/C13H27N3O.2ClH/c1-5-16(6-2)9-11(3)15-12(17)13(4)7-8-14-10-13;;/h11,14H,5-10H2,1-4H3,(H,15,17);2*1H |
| InChIKey | FEJGCPPIKHYXKN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |