C14H29Cl2N3O2 — CID 119861445
4-hydroxy-N-[(1-propylpiperidin-4-yl)methyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119861445) has the molecular formula C14H29Cl2N3O2 and a molecular weight of 342.31 g/mol. Its IUPAC name is 4-hydroxy-N-[(1-propylpiperidin-4-yl)methyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | 4-hydroxy-N-[(1-propylpiperidin-4-yl)methyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119861445 |
| Molecular Formula | C14H29Cl2N3O2 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-hydroxy-N-[(1-propylpiperidin-4-yl)methyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CCCN1CCC(CNC(=O)C2CC(O)CN2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H27N3O2.2ClH/c1-2-5-17-6-3-11(4-7-17)9-16-14(19)13-8-12(18)10-15-13;;/h11-13,15,18H,2-10H2,1H3,(H,16,19);2*1H |
| InChIKey | VVLDXFPJLCUUJZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |