C16H22FN3O2 — CID 119862653
N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]morpholine-2-carboxamide (PubChem CID 119862653) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]morpholine-2-carboxamide.
| Compound Name | N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119862653 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]morpholine-2-carboxamide |
| SMILES | O=C(NCC1CCN(c2ccc(F)cc2)C1)C1CNCCO1 |
| InChI | InChI=1S/C16H22FN3O2/c17-13-1-3-14(4-2-13)20-7-5-12(11-20)9-19-16(21)15-10-18-6-8-22-15/h1-4,12,15,18H,5-11H2,(H,19,21) |
| InChIKey | GDBJQJOZQAZYEC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |