C19H37Cl2N3O — CID 119863514
N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119863514) has the molecular formula C19H37Cl2N3O and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119863514 |
| Molecular Formula | C19H37Cl2N3O |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CC1CC(C)CN(CC(C)NC(=O)C2CC3CCCCC3N2)C1.Cl.Cl |
| InChI | InChI=1S/C19H35N3O.2ClH/c1-13-8-14(2)11-22(10-13)12-15(3)20-19(23)18-9-16-6-4-5-7-17(16)21-18;;/h13-18,21H,4-12H2,1-3H3,(H,20,23);2*1H |
| InChIKey | SNJRIIZYIADSTE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |