C16H30N2O — CID 43579335
N-(5-methylhexan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 43579335) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-(5-methylhexan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 43579335 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N-(5-methylhexan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC(C)CCC(C)NC(=O)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C16H30N2O/c1-11(2)8-9-12(3)17-16(19)15-10-13-6-4-5-7-14(13)18-15/h11-15,18H,4-10H2,1-3H3,(H,17,19) |
| InChIKey | LZVAASAAWSREBR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |