C13H20N4O2S — CID 119863934
morpholin-3-yl-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 119863934) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is morpholin-3-yl-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | morpholin-3-yl-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 119863934 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | morpholin-3-yl-[4-(1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(C1COCCN1)N1CCCN(c2nccs2)CC1 |
| InChI | InChI=1S/C13H20N4O2S/c18-12(11-10-19-8-2-14-11)16-4-1-5-17(7-6-16)13-15-3-9-20-13/h3,9,11,14H,1-2,4-8,10H2 |
| InChIKey | RNZZLOKOAYRGHL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |