C13H21Cl2N5O2 — CID 119854081
morpholin-3-yl-(4-pyrazin-2-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119854081) has the molecular formula C13H21Cl2N5O2 and a molecular weight of 350.25 g/mol. Its IUPAC name is morpholin-3-yl-(4-pyrazin-2-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | morpholin-3-yl-(4-pyrazin-2-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119854081 |
| Molecular Formula | C13H21Cl2N5O2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | morpholin-3-yl-(4-pyrazin-2-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1COCCN1)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C13H19N5O2.2ClH/c19-13(11-10-20-8-3-15-11)18-6-4-17(5-7-18)12-9-14-1-2-16-12;;/h1-2,9,11,15H,3-8,10H2;2*1H |
| InChIKey | RIESXAJHUKIVKH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |