C14H31Cl2N3O2 — CID 119866597
2-(2-methoxyethylamino)-N-[2-(4-methylpiperidin-1-yl)propyl]acetamide;dihydrochloride (PubChem CID 119866597) has the molecular formula C14H31Cl2N3O2 and a molecular weight of 344.33 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-(4-methylpiperidin-1-yl)propyl]acetamide;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-(4-methylpiperidin-1-yl)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119866597 |
| Molecular Formula | C14H31Cl2N3O2 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-(4-methylpiperidin-1-yl)propyl]acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NCC(C)N1CCC(C)CC1.Cl.Cl |
| InChI | InChI=1S/C14H29N3O2.2ClH/c1-12-4-7-17(8-5-12)13(2)10-16-14(18)11-15-6-9-19-3;;/h12-13,15H,4-11H2,1-3H3,(H,16,18);2*1H |
| InChIKey | ZKXBKMALRKGYAA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|