C19H28N4O3 — CID 119866742
3-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 119866742) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119866742 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 3-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCN(C)CC2)cc1NC(=O)C1CCC(N)C1 |
| InChI | InChI=1S/C19H28N4O3/c1-22-7-9-23(10-8-22)19(25)14-4-6-17(26-2)16(12-14)21-18(24)13-3-5-15(20)11-13/h4,6,12-13,15H,3,5,7-11,20H2,1-2H3,(H,21,24) |
| InChIKey | FXGRGRJVDARPGO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |