C12H20N4O — CID 119867897
(2S)-2-amino-N,4-dimethyl-N-(pyrazin-2-ylmethyl)pentanamide (PubChem CID 119867897) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is (2S)-2-amino-N,4-dimethyl-N-(pyrazin-2-ylmethyl)pentanamide.
| Compound Name | (2S)-2-amino-N,4-dimethyl-N-(pyrazin-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 119867897 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (2S)-2-amino-N,4-dimethyl-N-(pyrazin-2-ylmethyl)pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N(C)Cc1cnccn1 |
| InChI | InChI=1S/C12H20N4O/c1-9(2)6-11(13)12(17)16(3)8-10-7-14-4-5-15-10/h4-5,7,9,11H,6,8,13H2,1-3H3/t11-/m0/s1 |
| InChIKey | JCKYKIWBMZIJLL-NSHDSACASA-N |
| XLogP | 0.81 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |