C9H15N3O — CID 62333203
1-[methyl(pyrazin-2-ylmethyl)amino]propan-2-ol (PubChem CID 62333203) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-[methyl(pyrazin-2-ylmethyl)amino]propan-2-ol.
| Compound Name | 1-[methyl(pyrazin-2-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 62333203 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-[methyl(pyrazin-2-ylmethyl)amino]propan-2-ol |
| SMILES | CC(O)CN(C)Cc1cnccn1 |
| InChI | InChI=1S/C9H15N3O/c1-8(13)6-12(2)7-9-5-10-3-4-11-9/h3-5,8,13H,6-7H2,1-2H3 |
| InChIKey | LWBFTDDTXRTWMN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |