C18H25N3O — CID 77083522
1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-N-methyl-N-(pyrazin-2-ylmethyl)methanamine (PubChem CID 77083522) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-N-methyl-N-(pyrazin-2-ylmethyl)methanamine.
| Compound Name | 1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-N-methyl-N-(pyrazin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 77083522 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-N-methyl-N-(pyrazin-2-ylmethyl)methanamine |
| SMILES | COc1cc(C)c(CN(C)Cc2cnccn2)cc1C(C)C |
| InChI | InChI=1S/C18H25N3O/c1-13(2)17-9-15(14(3)8-18(17)22-5)11-21(4)12-16-10-19-6-7-20-16/h6-10,13H,11-12H2,1-5H3 |
| InChIKey | KUYUQAFAHIQFBT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |