C20H31N3OS — CID 119869797
3-piperidin-4-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]butanamide (PubChem CID 119869797) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]butanamide.
| Compound Name | 3-piperidin-4-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 119869797 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 3-piperidin-4-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]butanamide |
| SMILES | CC(CC(=O)Nc1cccc(CN2CCSCC2)c1)C1CCNCC1 |
| InChI | InChI=1S/C20H31N3OS/c1-16(18-5-7-21-8-6-18)13-20(24)22-19-4-2-3-17(14-19)15-23-9-11-25-12-10-23/h2-4,14,16,18,21H,5-13,15H2,1H3,(H,22,24) |
| InChIKey | HXYOJEJKEFOHFE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |