C17H27Cl2N3OS — CID 119869806
2-pyrrolidin-2-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride (PubChem CID 119869806) has the molecular formula C17H27Cl2N3OS and a molecular weight of 392.40 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-pyrrolidin-2-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119869806 |
| Molecular Formula | C17H27Cl2N3OS |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-[3-(thiomorpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CCCN1)Nc1cccc(CN2CCSCC2)c1 |
| InChI | InChI=1S/C17H25N3OS.2ClH/c21-17(12-15-5-2-6-18-15)19-16-4-1-3-14(11-16)13-20-7-9-22-10-8-20;;/h1,3-4,11,15,18H,2,5-10,12-13H2,(H,19,21);2*1H |
| InChIKey | KGLUWAPDAIIXJR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |