C17H27ClN2O3S — CID 119784319
N-[3-(tert-butylsulfonylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride (PubChem CID 119784319) has the molecular formula C17H27ClN2O3S and a molecular weight of 374.93 g/mol. Its IUPAC name is N-[3-(tert-butylsulfonylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride.
| Compound Name | N-[3-(tert-butylsulfonylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119784319 |
| Molecular Formula | C17H27ClN2O3S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[3-(tert-butylsulfonylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
| SMILES | CC(C)(C)S(=O)(=O)Cc1cccc(NC(=O)CC2CCCN2)c1.Cl |
| InChI | InChI=1S/C17H26N2O3S.ClH/c1-17(2,3)23(21,22)12-13-6-4-7-15(10-13)19-16(20)11-14-8-5-9-18-14;/h4,6-7,10,14,18H,5,8-9,11-12H2,1-3H3,(H,19,20);1H |
| InChIKey | DUKVSLGYFMIOQT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |