C15H21Cl2N5O — CID 119871178
N-[1-(pyridin-4-ylmethyl)pyrazol-4-yl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119871178) has the molecular formula C15H21Cl2N5O and a molecular weight of 358.27 g/mol. Its IUPAC name is N-[1-(pyridin-4-ylmethyl)pyrazol-4-yl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[1-(pyridin-4-ylmethyl)pyrazol-4-yl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119871178 |
| Molecular Formula | C15H21Cl2N5O |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[1-(pyridin-4-ylmethyl)pyrazol-4-yl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cnn(Cc2ccncc2)c1)C1CCCNC1 |
| InChI | InChI=1S/C15H19N5O.2ClH/c21-15(13-2-1-5-17-8-13)19-14-9-18-20(11-14)10-12-3-6-16-7-4-12;;/h3-4,6-7,9,11,13,17H,1-2,5,8,10H2,(H,19,21);2*1H |
| InChIKey | NCOMPXBIUDYLSY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |