C21H27N3O2 — CID 119872345
4-(aminomethyl)-N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]benzamide (PubChem CID 119872345) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 119872345 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]benzamide |
| SMILES | NCc1ccc(C(=O)Nc2cccc(CN3CCC(CO)CC3)c2)cc1 |
| InChI | InChI=1S/C21H27N3O2/c22-13-16-4-6-19(7-5-16)21(26)23-20-3-1-2-18(12-20)14-24-10-8-17(15-25)9-11-24/h1-7,12,17,25H,8-11,13-15,22H2,(H,23,26) |
| InChIKey | VJJPVSLONNOYKM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |