C19H26N4O2 — CID 71916687
N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]-3-pyrazol-1-ylpropanamide (PubChem CID 71916687) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]-3-pyrazol-1-ylpropanamide.
| Compound Name | N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 71916687 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]-3-pyrazol-1-ylpropanamide |
| SMILES | O=C(CCn1cccn1)Nc1cccc(CN2CCC(CO)CC2)c1 |
| InChI | InChI=1S/C19H26N4O2/c24-15-16-5-10-22(11-6-16)14-17-3-1-4-18(13-17)21-19(25)7-12-23-9-2-8-20-23/h1-4,8-9,13,16,24H,5-7,10-12,14-15H2,(H,21,25) |
| InChIKey | CSWGVVHLQBXGPU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |