C11H27Cl2N3O — CID 119874323
4-amino-N-[2-[butan-2-yl(methyl)amino]ethyl]butanamide;dihydrochloride (PubChem CID 119874323) has the molecular formula C11H27Cl2N3O and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-amino-N-[2-[butan-2-yl(methyl)amino]ethyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-N-[2-[butan-2-yl(methyl)amino]ethyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119874323 |
| Molecular Formula | C11H27Cl2N3O |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-amino-N-[2-[butan-2-yl(methyl)amino]ethyl]butanamide;dihydrochloride |
| SMILES | CCC(C)N(C)CCNC(=O)CCCN.Cl.Cl |
| InChI | InChI=1S/C11H25N3O.2ClH/c1-4-10(2)14(3)9-8-13-11(15)6-5-7-12;;/h10H,4-9,12H2,1-3H3,(H,13,15);2*1H |
| InChIKey | ZKAXQFRAPQEZEM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |