C10H24ClN3O — CID 120704264
N-[2-[butan-2-yl(methyl)amino]ethyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 120704264) has the molecular formula C10H24ClN3O and a molecular weight of 237.77 g/mol. Its IUPAC name is N-[2-[butan-2-yl(methyl)amino]ethyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[2-[butan-2-yl(methyl)amino]ethyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120704264 |
| Molecular Formula | C10H24ClN3O |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N-[2-[butan-2-yl(methyl)amino]ethyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCC(C)N(C)CCNC(=O)CNC.Cl |
| InChI | InChI=1S/C10H23N3O.ClH/c1-5-9(2)13(4)7-6-12-10(14)8-11-3;/h9,11H,5-8H2,1-4H3,(H,12,14);1H |
| InChIKey | ZUYGAIPLYWPJNB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |