C12H25Cl2N3O2 — CID 119876503
N-[2-(3-methylmorpholin-4-yl)ethyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119876503) has the molecular formula C12H25Cl2N3O2 and a molecular weight of 314.26 g/mol. Its IUPAC name is N-[2-(3-methylmorpholin-4-yl)ethyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(3-methylmorpholin-4-yl)ethyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119876503 |
| Molecular Formula | C12H25Cl2N3O2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[2-(3-methylmorpholin-4-yl)ethyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CC1COCCN1CCNC(=O)C1CCCN1.Cl.Cl |
| InChI | InChI=1S/C12H23N3O2.2ClH/c1-10-9-17-8-7-15(10)6-5-14-12(16)11-3-2-4-13-11;;/h10-11,13H,2-9H2,1H3,(H,14,16);2*1H |
| InChIKey | CTVONVKMOZLEGA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |