C21H30Cl2N4O — CID 119878601
(3-aminophenyl)-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119878601) has the molecular formula C21H30Cl2N4O and a molecular weight of 425.40 g/mol. Its IUPAC name is (3-aminophenyl)-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119878601 |
| Molecular Formula | C21H30Cl2N4O |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (3-aminophenyl)-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]methanone;dihydrochloride |
| SMILES | CN(CCN1CCN(C(=O)c2cccc(N)c2)CC1)Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C21H28N4O.2ClH/c1-23(17-18-6-3-2-4-7-18)10-11-24-12-14-25(15-13-24)21(26)19-8-5-9-20(22)16-19;;/h2-9,16H,10-15,17,22H2,1H3;2*1H |
| InChIKey | IUGPJQKAJHFTOU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|