C16H25ClN4O — CID 166676837
(4-amino-2-chlorophenyl)-[4-[2-[ethyl(methyl)amino]ethyl]piperazin-1-yl]methanone (PubChem CID 166676837) has the molecular formula C16H25ClN4O and a molecular weight of 324.86 g/mol. Its IUPAC name is (4-amino-2-chlorophenyl)-[4-[2-[ethyl(methyl)amino]ethyl]piperazin-1-yl]methanone.
| Compound Name | (4-amino-2-chlorophenyl)-[4-[2-[ethyl(methyl)amino]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166676837 |
| Molecular Formula | C16H25ClN4O |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (4-amino-2-chlorophenyl)-[4-[2-[ethyl(methyl)amino]ethyl]piperazin-1-yl]methanone |
| SMILES | CCN(C)CCN1CCN(C(=O)c2ccc(N)cc2Cl)CC1 |
| InChI | InChI=1S/C16H25ClN4O/c1-3-19(2)6-7-20-8-10-21(11-9-20)16(22)14-5-4-13(18)12-15(14)17/h4-5,12H,3,6-11,18H2,1-2H3 |
| InChIKey | YDLOQWSOAAMELG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|